🎓 BookMCQ
← Back to 7. Applications of the Definite Integral In Geometry, Science, and Engineering

📝 Hyperbolic functions sinh cosh tanh graphs (35 MCQs)

📖 From Calculus • 7. Applications of the Definite Integral In Geometry, Science, and Engineering • 35 questions available

What is Hyperbolic functions sinh cosh tanh graphs?

Definition:
Hyperbolic sine is sinhx=exex2\sinh x = \frac{e^x - e^{-x}}{2} and cosine is coshx=ex+ex2\cosh x = \frac{e^x + e^{-x}}{2}. Tangent is tanhx=sinhxcoshx\tanh x = \frac{\sinh x}{\cosh x}. Their graphs resemble trigonometric functions but are based on exponentials, with cosh forming a catenary curve.

Example:
Calculate cosh(0)\cosh(0). Solution: cosh(0)=e0+e02=1+12=1\cosh(0) = \frac{e^0 + e^{-0}}{2} = \frac{1+1}{2} = 1. Graph passes through (0,1).

Reason:
Hyperbolic functions describe natural phenomena like hanging cables (catenaries) and special relativity equations, offering a mathematical framework for systems involving exponential growth and decay combinations.

17
Easy
13
Medium
5
Hard

📝 All Hyperbolic functions sinh cosh tanh graphs MCQs

Q1. Which of the following correctly defines coshx\cosh x in terms of exponential functions?

A.ex+ex2\frac{e^x + e^{-x}}{2}
B.exex2\frac{e^x - e^{-x}}{2}
C.ex+exexex\frac{e^x + e^{-x}}{e^x - e^{-x}}
D.2ex+ex\frac{2}{e^x + e^{-x}}
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: The hyperbolic cosine function coshx\cosh x is defined as the average of exe^x and exe^{-x}. This mathematical definition mirrors the standard algebraic form (a+b)/2(a + b)/2 and serves as the basis for many identities. The other options incorrectly represent the hyperbolic sine function or are reciprocals of sums/differences.

Q2. What is the value of sinh(0)\sinh(0) according to its exponential definition?

A.0 ✅
B.1
C.-1
D.Undefined
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: Substituting x=0x = 0 into the definition sinhx=exex2\sinh x = \frac{e^x - e^{-x}}{2} yields 112=0\frac{1 - 1}{2} = 0. This demonstrates the odd symmetry of the function. Unlike trigonometric sine which starts at zero, the exponential combination ensures this point passes through the origin.

Q3. A student claims that the range of y=sinhxy = \sinh x is [0,)[0, \infty). What error has the student made?

A.They assumed the graph is always positive
B.They confused it with coshx\cosh x
C.They incorrectly evaluated the limit at infinity
D.All of the above ✅
💡 Difficulty: easy | ✅ Correct: D

📖 Explanation: The student has made a fundamental conceptual error. The function sinhx\sinh x takes all real values (range is ,-\infty, \infty), whereas coshx\cosh x is always positive. This misconception often arises from visualizing only the positive xx-axis or confusing the behavior of even and odd functions.

Q4. If sinhx=34\sinh x = \frac{3}{4}, what is the exact value of coshx\cosh x?

A.54\frac{5}{4}
B.43\frac{4}{3}
C.74\sqrt{\frac{7}{4}}
D.34\frac{3}{4}
💡 Difficulty: medium | ✅ Correct: A

📖 Explanation: The fundamental identity cosh2xsinh2x=1\cosh^2 x - \sinh^2 x = 1 is a defining property. Substituting sinhx=3/4\sinh x = 3/4 gives cosh2x=1+(9/16)=25/16\cosh^2 x = 1 + (9/16) = 25/16. Since coshx\cosh x is always positive for real xx, the principal value is 5/45/4. This forces students to recall constraints on the range.

Q5. Which statement about the graph of y=coshxy = \cosh x and its curvilinear asymptotes is true?

A.It is bounded below by y=0y=0
B.It approaches y=12exy = \frac{1}{2}e^x as xx \to \infty
C.It has vertical asymptotes
D.It is symmetric about the origin
💡 Difficulty: medium | ✅ Correct: B

📖 Explanation: The graph of y=coshxy = \cosh x grows exponentially. As xx \to \infty, the term exe^{-x} becomes negligible, so coshx12ex\cosh x \approx \frac{1}{2}e^x. This makes y=12exy = \frac{1}{2}e^x a curvilinear asymptote. Option A is false because the range is [1,)[1, \infty); it never touches the x-axis.

Q6. The parametric equations x=coshtx = \cosh t and y=sinhty = \sinh t represent which curve?

A.A unit circle
B.A parabola
C.The right half of a unit hyperbola ✅
D.An ellipse
💡 Difficulty: hard | ✅ Correct: C

📖 Explanation: Using the identity cosh2tsinh2t=1\cosh^2 t - \sinh^2 t = 1, the parametric equations satisfy x2y2=1x^2 - y^2 = 1 with x1x \ge 1. This curve is the right branch of the unit hyperbola. This tests if the student can connect the functions to their geometric origin (the hyperbola), as opposed to the circle represented by trigonometric functions.

Q7. Two students are asked to evaluate tanh(ln4)\tanh(\ln 4). Student A simplifies it algebraically; Student B evaluates it numerically. What is the correct value?

A.817\frac{8}{17}
B.1517\frac{15}{17}
C.178\frac{17}{8}
D.158\frac{15}{8}
💡 Difficulty: medium | ✅ Correct: B

📖 Explanation: Using the exponential definition: tanh(ln4)=eln4eln4eln4+eln4=41/44+1/4=15/417/4=15/17\tanh(\ln 4) = \frac{e^{\ln 4} - e^{-\ln 4}}{e^{\ln 4} + e^{-\ln 4}} = \frac{4 - 1/4}{4 + 1/4} = \frac{15/4}{17/4} = 15/17. This requires the student to know that elna=ae^{\ln a} = a and then carefully simplify the compound fraction.

Q8. Which of the following identities is TRUE for all real xx?

A.sinh(x)=sinhx\sinh(-x) = \sinh x
B.cosh(x)=coshx\cosh(-x) = -\cosh x
C.cosh2x+sinh2x=1\cosh^2 x + \sinh^2 x = 1
D.1tanh2x=\sech2x1 - \tanh^2 x = \sech^2 x
💡 Difficulty: easy | ✅ Correct: D

📖 Explanation: The identity 1tanh2x=\sech2x1 - \tanh^2 x = \sech^2 x is derived by dividing the Pythagorean identity cosh2xsinh2x=1\cosh^2 x - \sinh^2 x = 1 by cosh2x\cosh^2 x. Options A and B confuse even/odd symmetries, and C should be a difference, not a sum (which is characteristic of the circle, not the hyperbola).

Q9. A flexible cable suspended between two points forms a curve called a catenary with equation y=acosh(x/a)y = a \cosh(x/a). What property of coshx\cosh x makes it suitable for this real-world Medium?

A.It is the solution to y'' = y
B.It is periodic
C.It is bounded
D.It models a parabola
💡 Difficulty: medium | ✅ Correct: A

📖 Explanation: The catenary equation y=acosh(x/a)y = a \cosh(x/a) models the curve of a hanging chain. This is derived from minimizing potential energy, which leads to a differential equation whose solution is cosh\cosh. The key mathematical property is that the second derivative of coshx\cosh x is coshx\cosh x, representing a system where curvature is proportional to height.

Q10. What is the domain of the hyperbolic secant function \sechx\sech x?

A.(,)(-\infty, \infty)
B.(0,1](0, 1]
C.(,1][1,)(-\infty, -1] \cup [1, \infty)
D.All real numbers except 00
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: \sechx=1coshx\sech x = \frac{1}{\cosh x}. Since coshx\cosh x is always greater than or equal to 1 for all real xx, it is never zero. Therefore, the reciprocal \sechx\sech x is defined for all real numbers, making its domain (,)(-\infty, \infty). Its range is a subset of (0,1](0,1].

Q11. The hyperbolic sine function is the result of applying a transformation to exponential functions. Which transformation is it?

A.The sum of exe^x and exe^{-x} divided by 2
B.The difference of exe^x and exe^{-x} divided by 2 ✅
C.The sum of exe^x and exe^{-x}
D.The product of exe^x and exe^{-x}
💡 Difficulty: easy | ✅ Correct: B

📖 Explanation: The sinhx\sinh x function is the odd part of exe^x. While exe^x is neither even nor odd, it can be decomposed into an even part (cosh\cosh) and an odd part (sinh\sinh). The odd part is obtained by taking the difference, which ensures the function is antisymmetric (f(-x) = -f(x)).

Q12. If a graph represents y=acosh(x/a)y = a \cosh(x/a), what does the parameter aa affect regarding the shape?

A.It shifts the graph vertically
B.It controls the 'width' and curvature of the parabola-like shape ✅
C.It reflects the graph across the x-axis
D.It rotates the graph
💡 Difficulty: easy | ✅ Correct: B

📖 Explanation: The equation y=acosh(x/a)y = a \cosh(x/a) describes a family of catenaries. The parameter aa scales both xx and yy coordinates. It effectively controls the tightness of the curve; larger aa makes the curve flatter near the bottom. It does not just shift or reflect; it modifies the intrinsic shape (curvature).

Q13. A student incorrectly states that coshx\cosh x and secx\sec x are reciprocals. What is the correct relationship between coshx\cosh x and \sechx\sech x?

A.coshx\sechx=1\cosh x \cdot \sech x = 1
B.coshx=secx\cosh x = \sec x
C.\sechx=1sinhx\sech x = \frac{1}{\sinh x}
D.They are unrelated
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: This is a common notation mistake. The hyperbolic secant \sechx\sech x is defined as the reciprocal of the hyperbolic cosine: \sechx=1/coshx\sech x = 1/\cosh x. The student likely confused hyperbolic functions with trigonometric functions, where secx\sec x is the reciprocal of cosx\cos x, but the notation for hyperbolic functions uses 'h' to distinguish them.

Q14. Solve the equation coshx=3\cosh x = 3 for xx. Which of the following represents the exact solution?

A.ln(3+8)\ln(3 + \sqrt{8})
B.ln(38)\ln(3 - \sqrt{8})
C.e3+e32\frac{e^3 + e^{-3}}{2}
D.sinh1(3)\sinh^{-1}(3)
💡 Difficulty: medium | ✅ Correct: A

📖 Explanation: Solving coshx=3\cosh x = 3 requires using the logarithmic definition: x=cosh1(3)=ln(3+321)=ln(3+8)x = \cosh^{-1}(3) = \ln(3 + \sqrt{3^2 - 1}) = \ln(3 + \sqrt{8}). The inverse hyperbolic cosine is a multi-valued function; we take the principal positive branch, which is the sum, not the difference.

Q15. Which of the following is the graph of y=tanhxy = \tanh x?

A.S-shaped curve passing through the origin ✅
B.U-shaped curve
C.V-shaped curve
D.Exponential curve
💡 Difficulty: medium | ✅ Correct: A

📖 Explanation: tanhx\tanh x has a characteristic S-shape (sigmoidal). It passes through the origin and has horizontal asymptotes at y=1y = -1 and y=1y = 1. The U-shaped curve belongs to coshx\cosh x, and a V-shape is associated with absolute value functions. Understanding the limits limx±tanhx=±1\lim_{x \to \pm\infty} \tanh x = \pm 1 is key to differentiating it.

Q16. What is the relationship between the derivative of sinhx\sinh x and its graph's slope?

A.The derivative is coshx\cosh x, which is always positive ✅
B.The derivative is sinhx\sinh x
C.The derivative is coshx\cosh x, which is always negative
D.The derivative oscillates
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: The derivative of sinhx\sinh x is coshx\cosh x. Since coshx1\cosh x \ge 1 for all real xx, the slope of the graph of y=sinhxy = \sinh x is always positive. This confirms that sinhx\sinh x is strictly increasing over its entire domain, which is a key difference from sinx\sin x, whose derivative fluctuates.

Q17. Given the complex identity cosh(ix)=cosx\cosh(ix) = \cos x, how does this challenge our interpretation of hyperbolic vs. trigonometric functions?

A.They are exactly the same in the real plane
B.Hyperbolic functions are just the analytic continuation of trigonometric functions ✅
C.One is an approximation of the other
D.They have no relation
💡 Difficulty: hard | ✅ Correct: B

📖 Explanation: This is a profound concept linking real and complex analysis. The identity cosh(ix)=cosx\cosh(ix) = \cos x shows that the hyperbolic functions are the real and imaginary parts of the trigonometric functions (and vice versa) when evaluated at complex arguments. This indicates they are fundamentally connected through analytic continuation, representing different 'real slices' of the same complex analytic function.

Q18. Consider the functions f(x)=coshxf(x) = \cosh x and g(x)=sinhxg(x) = \sinh x. What is the minimum value of f(x)f(x) and the range of g(x)g(x)?

A.Min of f is 1; range of g is (,)(-\infty,\infty)
B.Min of f is 0; range of g is (0,)(0,\infty)
C.Min of f is 1; range of g is [0,)[0,\infty)
D.Min of f is 0; range of g is (,)(-\infty,\infty)
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: coshx\cosh x has a minimum value of 1 at x=0x=0. sinhx\sinh x is unbounded above and below, taking all real values, so its range is the entire set of real numbers. These are direct properties visible from the definitions and graphs. The 'min' of cosh\cosh is often confused with being 0.

Q19. In the context of relativity, rapidity is defined using tanh1\tanh^{-1} because of its additive property. This is analogous to which property of tan1\tan^{-1} in geometry?

A.They both add angles
B.They both convert products to sums ✅
C.They are both bounded by 1-1 and 11
D.They both have a linear graph
💡 Difficulty: medium | ✅ Correct: B

📖 Explanation: The rapidity w=tanh1(v/c)w = \tanh^{-1}(v/c) is additive for velocities. This is analogous to how adding angles in Euclidean geometry corresponds to multiplying complex numbers (or using tan\tan addition formulas). The hyperbolic tangent addition formula tanh(a+b)=tanha+tanhb1+tanhatanhb\tanh(a+b) = \frac{\tanh a + \tanh b}{1 + \tanh a \tanh b} mimics the tangent formula, but with a minus sign, reflecting the geometry of spacetime.

Q20. A student is asked to sketch y=3cosh(x/2)y = 3\cosh(x/2). What error might they make in the y-scaling?

A.They might shift the graph down to y=0y=0
B.They might ignore the factor 3, keeping the asymptote at y=1y=1
C.They might stretch the graph horizontally by a factor of 2 correctly
D.They might compress the graph vertically by a factor of 3
💡 Difficulty: easy | ✅ Correct: B

📖 Explanation: The student might correctly scale the x-axis (horizontal stretch by factor 2) but might incorrectly maintain the horizontal asymptote at y=1y=1 instead of moving it to y=3y=3 or incorrectly scaling the y values. The vertical scaling multiplies all y-values by 3, so the minimum becomes 33, not the asymptote.

Q21. Which of the following parametric curves corresponds to t(cosht,sinht)t \to (\cosh t, \sinh t) over <t<-\infty < t < \infty?

A.The right branch of the hyperbola x2y2=1x^2 - y^2 = 1
B.The left branch of the hyperbola x2y2=1x^2 - y^2 = 1
C.The right branch of the hyperbola x2y2=1x^2 - y^2 = -1
D.A unit circle
💡 Difficulty: hard | ✅ Correct: A

📖 Explanation: The parametric coordinates (cosht,sinht)(\cosh t, \sinh t) satisfy x2y2=1x^2 - y^2 = 1. Since cosht1\cosh t \ge 1, we are restricted to the right branch. This is the fundamental geometric definition. The left branch would require negative xx, which cosh\cosh cannot provide, and the difference of squares is the key characteristic.

Q22. Why is the graph of coshx\cosh x referred to as a 'catenary' or 'chain curve'?

A.Because its shape is the same as that of a hanging chain under its own weight ✅
B.Because it is the inverse of a sine wave
C.Because it is defined as a chain of functions
D.Because it is a common curve in fashion design
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: The name 'catenary' comes from the Latin for 'chain'. It is the curve that an ideal, flexible chain (or cable) assumes when supported at its ends and acted upon only by its own weight. The mathematical description of this physical problem leads exactly to the cosh\cosh function, showcasing how abstract mathematics models natural phenomena.

Q23. Given coshx=1.5\cosh x = 1.5, determine the value of sinhx\sinh x using the identity.

A.±1.25\pm \sqrt{1.25}
B.±2.25\pm \sqrt{2.25}
C.±0.5\pm 0.5
D.±1.25\pm 1.25
💡 Difficulty: medium | ✅ Correct: A

📖 Explanation: Using the identity sinh2x=cosh2x1\sinh^2 x = \cosh^2 x - 1. Plugging in 1.51.5 gives 2.251=1.252.25 - 1 = 1.25. So sinhx=±1.25\sinh x = \pm \sqrt{1.25}. The sign depends on the value of xx; since cosh\cosh is even, it doesn't determine the sign of sinh\sinh, which is odd. This reinforces the importance of keeping track of the domain/sign.

Q24. A student evaluates tanhx\tanh x for large positive xx as 1. What assumption about the growth of exponentials are they making?

A.That exe^{-x} becomes negligible relative to exe^x
B.That exe^x and exe^{-x} grow at the same rate
C.That tanhx\tanh x approaches 12\frac{1}{2}
D.That exe^x is bounded
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: As xx \to \infty, exe^x \to \infty and ex0e^{-x} \to 0. Therefore, tanhxexex=1\tanh x \approx \frac{e^x}{e^x} = 1. The key is understanding that the negative exponential term decays to zero, allowing the ratio to approach 1. This concept is central to understanding horizontal asymptotes.

Q25. Which of the following equations represents a curve that is strictly concave up for all xx?

A.y=sinhxy = \sinh x
B.y=tanhxy = \tanh x
C.y=coshxy = \cosh x
D.y=\sechxy = \sech x
💡 Difficulty: medium | ✅ Correct: C

📖 Explanation: The second derivative of coshx\cosh x is coshx\cosh x, which is always positive. Thus, y=coshxy = \cosh x is concave up over its entire domain. The second derivative of sinhx\sinh x is sinhx\sinh x, which changes sign at zero, giving an inflection point. Understanding concavity requires analyzing the second derivative of these functions.

Q26. If tanhx=0\tanh x = 0, what is the exact value of xx?

A.0
B.ln2\ln 2
C.cosh1(1)\cosh^{-1}(1)
D.Both A and C ✅
💡 Difficulty: hard | ✅ Correct: D

📖 Explanation: If tanhx=0\tanh x = 0, then sinhxcoshx=0\frac{\sinh x}{\cosh x} = 0, so sinhx=0\sinh x = 0. The only real solution to sinhx=0\sinh x = 0 is x=0x = 0. Since cosh(0)=1\cosh(0) = 1, cosh1(1)\cosh^{-1}(1) also evaluates to 0 (principal value). Both options A and C describe this same logical value.

Q27. What is the relationship between tanhx\tanh x and sinhx\sinh x if coshx\cosh x is an even function?

A.tanhx\tanh x is an odd function ✅
B.tanhx\tanh x is an even function
C.tanhx\tanh x is neither even nor odd
D.tanhx\tanh x is undefined
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: Since coshx\cosh x is even, cosh(x)=cosh(x)\cosh(-x) = \cosh(x). Since sinhx\sinh x is odd, sinh(x)=sinh(x)\sinh(-x) = -\sinh(x). Therefore, tanh(x)=sinhxcoshx=tanhx\tanh(-x) = \frac{-\sinh x}{\cosh x} = -\tanh x, proving tanhx\tanh x is odd. This demonstrates how composing even and odd functions affects the parity of the result.

Q28. A situation models the path of a ship's tow line as y=acosh(x/a)y = a \cosh(x/a). If the line is raised, what does 'a' physically represent?

A.The horizontal distance to the lowest point
B.The shape parameter (a constant of the physical system) ✅
C.The height of the suspension point
D.The length of the cable
💡 Difficulty: medium | ✅ Correct: B

📖 Explanation: In the catenary model, 'a' is a parameter determined by the physical characteristics of the cable (like its density and tension), not a direct physical measurement like height or length. It effectively scales the curve. This tests whether the student confuses the mathematical parameter with a physical one.

Q29. Which of the following correctly describes sinhx\sinh x in terms of the unit hyperbola?

A.It represents the y-coordinate on the hyperbola x2y2=1x^2 - y^2 = 1
B.It represents the x-coordinate on the hyperbola x2y2=1x^2 - y^2 = 1
C.It represents the angle of the hyperbola
D.It represents the area of the hyperbola
💡 Difficulty: hard | ✅ Correct: A

📖 Explanation: Given the parameterization of the hyperbola x2y2=1x^2 - y^2 = 1 by x=coshtx = \cosh t and y=sinhty = \sinh t, sinht\sinh t represents the y-coordinate. This is analogous to sint\sin t representing the y-coordinate on the unit circle. This geometric interpretation reinforces the analogy between hyperbolic and circular functions.

Q30. What is the range of the hyperbolic tangent function tanhx\tanh x?

A.(1,1)(-1, 1)
B.[1,1][-1, 1]
C.(0,)(0, \infty)
D.(,)(- \infty, \infty)
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: The tanhx\tanh x function has horizontal asymptotes at y=1y = -1 and y=1y = 1. It approaches these values as x±x \to \pm\infty but never actually reaches them. Therefore, its range is the open interval (1,1)(-1, 1). This is a crucial property that differentiates it from other functions like cosh\cosh, which has a closed interval minimum.

Q31. If x=ln2x = \ln 2, what is the exact value of sinhx\sinh x?

A.34\frac{3}{4}
B.43\frac{4}{3}
C.54\frac{5}{4}
D.32\frac{3}{2}
💡 Difficulty: medium | ✅ Correct: A

📖 Explanation: Substituting x=ln2x = \ln 2 into the definition gives sinh(ln2)=eln2eln22=21/22=3/22=3/4\sinh(\ln 2) = \frac{e^{\ln 2} - e^{-\ln 2}}{2} = \frac{2 - 1/2}{2} = \frac{3/2}{2} = 3/4. This requires manipulating eln2=2e^{\ln 2} = 2 and simplifying fractions carefully, requiring fluency with exponential properties.

Q32. A common mistake is to write sech1x=cosh1(x)\operatorname{sech}^{-1} x = \cosh^{-1}(x). How is this misconception identified and corrected?

A.It is incorrect; sech1x\operatorname{sech}^{-1} x is the reciprocal of cosh1x\cosh^{-1} x
B.It is incorrect; sech1x=cosh1(1/x)\operatorname{sech}^{-1} x = \cosh^{-1}(1/x)
C.It is correct for all xx
D.It is only correct for x>1x>1
💡 Difficulty: easy | ✅ Correct: B

📖 Explanation: This notation is tricky. The notation f1f^{-1} usually means the inverse function. For sechx\operatorname{sech} x, its inverse sech1x\operatorname{sech}^{-1} x is indeed cosh1(1/x)\cosh^{-1}(1/x), not cosh1(x)\cosh^{-1}(x). The latter would represent the inverse of coshx\cosh x itself. This emphasizes the difference between a reciprocal and an inverse function, and is a common point of confusion.

Q33. To find the area under y=coshxy = \cosh x from x=0x = 0 to x=ln3x = \ln 3, which integral is correct?

A.0ln3sinhxdx\int_0^{\ln 3} \sinh x dx
B.0ln3coshxdx\int_0^{\ln 3} \cosh x dx
C.0ln3cosh2xdx\int_0^{\ln 3} \cosh^2 x dx
D.0ln3exdx\int_0^{\ln 3} e^x dx
💡 Difficulty: medium | ✅ Correct: B

📖 Explanation: The area under a curve is given by integrating the function itself. To find the area under coshx\cosh x, you integrate coshx\cosh x directly. The integral of coshx\cosh x is sinhx\sinh x. This tests the student's ability to recognize the direct Medium of the definite integral to a hyperbolic function, rather than needing to use identities.

Q34. Why does the point (0,0)(0, 0) act as a point of inflection for y=sinhxy = \sinh x?

A.Because y&#039;&#039; = \sinh x changes sign at x=0x = 0
B.Because y&#039;&#039; = \cosh x changes sign at x=0x = 0
C.Because y&#039; is zero at x=0x = 0
D.Because sinhx\sinh x is odd
💡 Difficulty: easy | ✅ Correct: A

📖 Explanation: For a point of inflection, the second derivative must change sign. y&#039; = \cosh x, y&#039;&#039; = \sinh x. sinhx\sinh x is negative for x<0x < 0 and positive for x>0x > 0, so it changes sign at zero. coshx\cosh x is never negative. This explains why the curve changes concavity at the origin.

Q35. The equation y=3\sech(2x)y = 3 \sech(2x) is a scaled version of \sech\sech. What is the maximum value of this function?

A.3 ✅
B.1
C.0.5
D.6
💡 Difficulty: medium | ✅ Correct: A

📖 Explanation: \sech(0)=1\sech(0) = 1 because cosh(0)=1\cosh(0) = 1. The maximum value of \sech(2x)\sech(2x) is 1 (since the reciprocal of the minimum of cosh\cosh). Multiplying by the vertical scale factor 3 makes the maximum value 3. This tests the effects of vertical scaling on functions, specifically the hyperbolic secant.

🔗 Related Topics (MCQs)